C19H22O6 — CID 144528201
5,7-dimethoxy-3,4-dihydro-2H-chromene;2-methoxybenzoic acid (PubChem CID 144528201) has the molecular formula C19H22O6 and a molecular weight of 346.38 g/mol. Its IUPAC name is 5,7-dimethoxy-3,4-dihydro-2H-chromene;2-methoxybenzoic acid.
| Compound Name | 5,7-dimethoxy-3,4-dihydro-2H-chromene;2-methoxybenzoic acid |
|---|---|
| PubChem CID | 144528201 |
| Molecular Formula | C19H22O6 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 5,7-dimethoxy-3,4-dihydro-2H-chromene;2-methoxybenzoic acid |
| SMILES | COc1cc(OC)c2c(c1)OCCC2.COc1ccccc1C(=O)O |
| InChI | InChI=1S/C11H14O3.C8H8O3/c1-12-8-6-10(13-2)9-4-3-5-14-11(9)7-8;1-11-7-5-3-2-4-6(7)8(9)10/h6-7H,3-5H2,1-2H3;2-5H,1H3,(H,9,10) |
| InChIKey | WAYGDUMPNFAXPA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |