About ethane;(4E)-N-ethyl-N,7-dimethylocta-4,6-dien-4-amine;methoxymethane
ethane;(4E)-N-ethyl-N,7-dimethylocta-4,6-dien-4-amine;methoxymethane (PubChem CID 144528750) has the molecular formula C18H41NO
and a molecular weight of 287.53 g/mol. Its IUPAC name is ethane;(4E)-N-ethyl-N,7-dimethylocta-4,6-dien-4-amine;methoxymethane.
Molecular Properties
| Compound Name | ethane;(4E)-N-ethyl-N,7-dimethylocta-4,6-dien-4-amine;methoxymethane |
| PubChem CID | 144528750 |
| Molecular Formula | C18H41NO |
| Molecular Weight | 287.53 g/mol |
| Exact Mass | 287.32 |
| IUPAC Name | ethane;(4E)-N-ethyl-N,7-dimethylocta-4,6-dien-4-amine;methoxymethane |
| SMILES | CC.CC.CCC/C(=C\C=C(C)C)N(C)CC.COC |
| InChI | InChI=1S/C12H23N.C2H6O.2C2H6/c1-6-8-12(13(5)7-2)10-9-11(3)4;1-3-2;2*1-2/h9-10H,6-8H2,1-5H3;1-2H3;2*1-2H3/b12-10+;;; |
| InChIKey | PEUIXRDOIGPUIV-AKMNYRKMSA-N |
| XLogP | 5.90 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 287.53 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(4E)-N-ethyl-N,7-dimethylocta-4,6-dien-4-amine;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(4E)-N-ethyl-N,7-dimethylocta-4,6-dien-4-amine;methoxymethane?
The IUPAC name of ethane;(4E)-N-ethyl-N,7-dimethylocta-4,6-dien-4-amine;methoxymethane (CID 144528750) is ethane;(4E)-N-ethyl-N,7-dimethylocta-4,6-dien-4-amine;methoxymethane.
What is the SMILES notation for ethane;(4E)-N-ethyl-N,7-dimethylocta-4,6-dien-4-amine;methoxymethane?
The canonical SMILES for ethane;(4E)-N-ethyl-N,7-dimethylocta-4,6-dien-4-amine;methoxymethane is CC.CC.CCC/C(=C\C=C(C)C)N(C)CC.COC.
What is the InChIKey of ethane;(4E)-N-ethyl-N,7-dimethylocta-4,6-dien-4-amine;methoxymethane?
The InChIKey is PEUIXRDOIGPUIV-AKMNYRKMSA-N. The full InChI is InChI=1S/C12H23N.C2H6O.2C2H6/c1-6-8-12(13(5)7-2)10-9-11(3)4;1-3-2;2*1-2/h9-10H,6-8H2,1-5H3;1-2H3;2*1-2H3/b12-10+;;;.
What are the key properties of ethane;(4E)-N-ethyl-N,7-dimethylocta-4,6-dien-4-amine;methoxymethane?
ethane;(4E)-N-ethyl-N,7-dimethylocta-4,6-dien-4-amine;methoxymethane has a molecular weight of 287.53 g/mol, XLogP of 5.90, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(4E)-N-ethyl-N,7-dimethylocta-4,6-dien-4-amine;methoxymethane is sourced from PubChem (CID 144528750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).