About (3R)-4-bis(4-methylphenyl)phosphoryl-2,3-dimethylbutan-2-ol
(3R)-4-bis(4-methylphenyl)phosphoryl-2,3-dimethylbutan-2-ol (PubChem CID 144528974) has the molecular formula C20H27O2P
and a molecular weight of 330.41 g/mol. Its IUPAC name is (3R)-4-bis(4-methylphenyl)phosphoryl-2,3-dimethylbutan-2-ol.
Molecular Properties
| Compound Name | (3R)-4-bis(4-methylphenyl)phosphoryl-2,3-dimethylbutan-2-ol |
| PubChem CID | 144528974 |
| Molecular Formula | C20H27O2P |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (3R)-4-bis(4-methylphenyl)phosphoryl-2,3-dimethylbutan-2-ol |
| SMILES | Cc1ccc(P(=O)(C[C@H](C)C(C)(C)O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H27O2P/c1-15-6-10-18(11-7-15)23(22,14-17(3)20(4,5)21)19-12-8-16(2)9-13-19/h6-13,17,21H,14H2,1-5H3/t17-/m0/s1 |
| InChIKey | JOYOFFBAVPRFNV-KRWDZBQOSA-N |
| XLogP | 4.02 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (3R)-4-bis(4-methylphenyl)phosphoryl-2,3-dimethylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-4-bis(4-methylphenyl)phosphoryl-2,3-dimethylbutan-2-ol?
The IUPAC name of (3R)-4-bis(4-methylphenyl)phosphoryl-2,3-dimethylbutan-2-ol (CID 144528974) is (3R)-4-bis(4-methylphenyl)phosphoryl-2,3-dimethylbutan-2-ol.
What is the SMILES notation for (3R)-4-bis(4-methylphenyl)phosphoryl-2,3-dimethylbutan-2-ol?
The canonical SMILES for (3R)-4-bis(4-methylphenyl)phosphoryl-2,3-dimethylbutan-2-ol is Cc1ccc(P(=O)(C[C@H](C)C(C)(C)O)c2ccc(C)cc2)cc1.
What is the InChIKey of (3R)-4-bis(4-methylphenyl)phosphoryl-2,3-dimethylbutan-2-ol?
The InChIKey is JOYOFFBAVPRFNV-KRWDZBQOSA-N. The full InChI is InChI=1S/C20H27O2P/c1-15-6-10-18(11-7-15)23(22,14-17(3)20(4,5)21)19-12-8-16(2)9-13-19/h6-13,17,21H,14H2,1-5H3/t17-/m0/s1.
What are the key properties of (3R)-4-bis(4-methylphenyl)phosphoryl-2,3-dimethylbutan-2-ol?
(3R)-4-bis(4-methylphenyl)phosphoryl-2,3-dimethylbutan-2-ol has a molecular weight of 330.41 g/mol, XLogP of 4.02, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-4-bis(4-methylphenyl)phosphoryl-2,3-dimethylbutan-2-ol is sourced from PubChem (CID 144528974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).