About methanamine;3-methylbutanal
methanamine;3-methylbutanal (PubChem CID 144530432) has the molecular formula C6H15NO
and a molecular weight of 117.19 g/mol. Its IUPAC name is methanamine;3-methylbutanal.
Molecular Properties
| Compound Name | methanamine;3-methylbutanal |
| PubChem CID | 144530432 |
| Molecular Formula | C6H15NO |
| Molecular Weight | 117.19 g/mol |
| Exact Mass | 117.12 |
| IUPAC Name | methanamine;3-methylbutanal |
| SMILES | CC(C)CC=O.CN |
| InChI | InChI=1S/C5H10O.CH5N/c1-5(2)3-4-6;1-2/h4-5H,3H2,1-2H3;2H2,1H3 |
| InChIKey | AQSJFWZHLWXZGC-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.19 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methanamine;3-methylbutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;3-methylbutanal?
The IUPAC name of methanamine;3-methylbutanal (CID 144530432) is methanamine;3-methylbutanal.
What is the SMILES notation for methanamine;3-methylbutanal?
The canonical SMILES for methanamine;3-methylbutanal is CC(C)CC=O.CN.
What is the InChIKey of methanamine;3-methylbutanal?
The InChIKey is AQSJFWZHLWXZGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O.CH5N/c1-5(2)3-4-6;1-2/h4-5H,3H2,1-2H3;2H2,1H3.
What are the key properties of methanamine;3-methylbutanal?
methanamine;3-methylbutanal has a molecular weight of 117.19 g/mol, XLogP of 0.81, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;3-methylbutanal is sourced from PubChem (CID 144530432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).