C19H35N3O — CID 144530441
4-ethyl-N-[2-(4-methylpiperazin-1-yl)ethyl]benzamide;molecular hydrogen;propane (PubChem CID 144530441) has the molecular formula C19H35N3O and a molecular weight of 321.51 g/mol. Its IUPAC name is 4-ethyl-N-[2-(4-methylpiperazin-1-yl)ethyl]benzamide;molecular hydrogen;propane.
| Compound Name | 4-ethyl-N-[2-(4-methylpiperazin-1-yl)ethyl]benzamide;molecular hydrogen;propane |
|---|---|
| PubChem CID | 144530441 |
| Molecular Formula | C19H35N3O |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.28 |
| IUPAC Name | 4-ethyl-N-[2-(4-methylpiperazin-1-yl)ethyl]benzamide;molecular hydrogen;propane |
| SMILES | CCC.CCc1ccc(C(=O)NCCN2CCN(C)CC2)cc1.[H][H] |
| InChI | InChI=1S/C16H25N3O.C3H8.H2/c1-3-14-4-6-15(7-5-14)16(20)17-8-9-19-12-10-18(2)11-13-19;1-3-2;/h4-7H,3,8-13H2,1-2H3,(H,17,20);3H2,1-2H3;1H |
| InChIKey | WMVGTTVSJUZWAW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |