C22H31NO3 — CID 144530534
4,4,11a-trimethyl-9-(2-oxopropyl)-1,2,3,5,6,6a,7,7a,10a,11-decahydronaphtho[1,2-f]isoindole-8,10-dione (PubChem CID 144530534) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is 4,4,11a-trimethyl-9-(2-oxopropyl)-1,2,3,5,6,6a,7,7a,10a,11-decahydronaphtho[1,2-f]isoindole-8,10-dione.
| Compound Name | 4,4,11a-trimethyl-9-(2-oxopropyl)-1,2,3,5,6,6a,7,7a,10a,11-decahydronaphtho[1,2-f]isoindole-8,10-dione |
|---|---|
| PubChem CID | 144530534 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | 4,4,11a-trimethyl-9-(2-oxopropyl)-1,2,3,5,6,6a,7,7a,10a,11-decahydronaphtho[1,2-f]isoindole-8,10-dione |
| SMILES | CC(=O)CN1C(=O)C2CC3CCC4=C(CCCC4(C)C)C3(C)CC2C1=O |
| InChI | InChI=1S/C22H31NO3/c1-13(24)12-23-19(25)15-10-14-7-8-17-18(6-5-9-21(17,2)3)22(14,4)11-16(15)20(23)26/h14-16H,5-12H2,1-4H3 |
| InChIKey | SSIXCKLIHYXFTO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|