About N-[2-amino-1-(3-hydroxy-3-methylbutyl)benzimidazol-5-yl]-2,2-dimethylbutanamide
N-[2-amino-1-(3-hydroxy-3-methylbutyl)benzimidazol-5-yl]-2,2-dimethylbutanamide (PubChem CID 144530614) has the molecular formula C18H28N4O2
and a molecular weight of 332.45 g/mol. Its IUPAC name is N-[2-amino-1-(3-hydroxy-3-methylbutyl)benzimidazol-5-yl]-2,2-dimethylbutanamide.
Molecular Properties
| Compound Name | N-[2-amino-1-(3-hydroxy-3-methylbutyl)benzimidazol-5-yl]-2,2-dimethylbutanamide |
| PubChem CID | 144530614 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | N-[2-amino-1-(3-hydroxy-3-methylbutyl)benzimidazol-5-yl]-2,2-dimethylbutanamide |
| SMILES | CCC(C)(C)C(=O)Nc1ccc2c(c1)nc(N)n2CCC(C)(C)O |
| InChI | InChI=1S/C18H28N4O2/c1-6-17(2,3)15(23)20-12-7-8-14-13(11-12)21-16(19)22(14)10-9-18(4,5)24/h7-8,11,24H,6,9-10H2,1-5H3,(H2,19,21)(H,20,23) |
| InChIKey | WPRQTEKHMATNQF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-amino-1-(3-hydroxy-3-methylbutyl)benzimidazol-5-yl]-2,2-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-amino-1-(3-hydroxy-3-methylbutyl)benzimidazol-5-yl]-2,2-dimethylbutanamide?
The IUPAC name of N-[2-amino-1-(3-hydroxy-3-methylbutyl)benzimidazol-5-yl]-2,2-dimethylbutanamide (CID 144530614) is N-[2-amino-1-(3-hydroxy-3-methylbutyl)benzimidazol-5-yl]-2,2-dimethylbutanamide.
What is the SMILES notation for N-[2-amino-1-(3-hydroxy-3-methylbutyl)benzimidazol-5-yl]-2,2-dimethylbutanamide?
The canonical SMILES for N-[2-amino-1-(3-hydroxy-3-methylbutyl)benzimidazol-5-yl]-2,2-dimethylbutanamide is CCC(C)(C)C(=O)Nc1ccc2c(c1)nc(N)n2CCC(C)(C)O.
What is the InChIKey of N-[2-amino-1-(3-hydroxy-3-methylbutyl)benzimidazol-5-yl]-2,2-dimethylbutanamide?
The InChIKey is WPRQTEKHMATNQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N4O2/c1-6-17(2,3)15(23)20-12-7-8-14-13(11-12)21-16(19)22(14)10-9-18(4,5)24/h7-8,11,24H,6,9-10H2,1-5H3,(H2,19,21)(H,20,23).
What are the key properties of N-[2-amino-1-(3-hydroxy-3-methylbutyl)benzimidazol-5-yl]-2,2-dimethylbutanamide?
N-[2-amino-1-(3-hydroxy-3-methylbutyl)benzimidazol-5-yl]-2,2-dimethylbutanamide has a molecular weight of 332.45 g/mol, XLogP of 3.15, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-amino-1-(3-hydroxy-3-methylbutyl)benzimidazol-5-yl]-2,2-dimethylbutanamide is sourced from PubChem (CID 144530614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).