C15H15FN2O3 — CID 144530682
(5E)-5-[(2E,4Z)-4-ethenyl-5-fluorohepta-2,4,6-trienylidene]-1-ethyl-1,3-diazinane-2,4,6-trione (PubChem CID 144530682) has the molecular formula C15H15FN2O3 and a molecular weight of 290.29 g/mol. Its IUPAC name is (5E)-5-[(2E,4Z)-4-ethenyl-5-fluorohepta-2,4,6-trienylidene]-1-ethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[(2E,4Z)-4-ethenyl-5-fluorohepta-2,4,6-trienylidene]-1-ethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 144530682 |
| Molecular Formula | C15H15FN2O3 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | (5E)-5-[(2E,4Z)-4-ethenyl-5-fluorohepta-2,4,6-trienylidene]-1-ethyl-1,3-diazinane-2,4,6-trione |
| SMILES | C=C/C(F)=C(C=C)/C=C/C=C1\C(=O)NC(=O)N(CC)C1=O |
| InChI | InChI=1S/C15H15FN2O3/c1-4-10(12(16)5-2)8-7-9-11-13(19)17-15(21)18(6-3)14(11)20/h4-5,7-9H,1-2,6H2,3H3,(H,17,19,21)/b8-7+,11-9+,12-10- |
| InChIKey | RFDBDTYLPLVRFS-CDIKDJIESA-N |
| XLogP | 2.16 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|