C17H17F2NO2 — CID 144530735
(3Z)-1-ethyl-3-[(2E,4E)-5-fluoro-4-(1-fluoroethenyl)hepta-2,4,6-trienylidene]-6-methylidenepiperidine-2,4-dione (PubChem CID 144530735) has the molecular formula C17H17F2NO2 and a molecular weight of 305.32 g/mol. Its IUPAC name is (3Z)-1-ethyl-3-[(2E,4E)-5-fluoro-4-(1-fluoroethenyl)hepta-2,4,6-trienylidene]-6-methylidenepiperidine-2,4-dione.
| Compound Name | (3Z)-1-ethyl-3-[(2E,4E)-5-fluoro-4-(1-fluoroethenyl)hepta-2,4,6-trienylidene]-6-methylidenepiperidine-2,4-dione |
|---|---|
| PubChem CID | 144530735 |
| Molecular Formula | C17H17F2NO2 |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | (3Z)-1-ethyl-3-[(2E,4E)-5-fluoro-4-(1-fluoroethenyl)hepta-2,4,6-trienylidene]-6-methylidenepiperidine-2,4-dione |
| SMILES | C=C/C(F)=C(/C=C/C=C1/C(=O)CC(=C)N(CC)C1=O)C(=C)F |
| InChI | InChI=1S/C17H17F2NO2/c1-5-15(19)13(12(4)18)8-7-9-14-16(21)10-11(3)20(6-2)17(14)22/h5,7-9H,1,3-4,6,10H2,2H3/b8-7+,14-9-,15-13+ |
| InChIKey | QKXRNTZEKUCOHF-CVXUVMKYSA-N |
| XLogP | 3.70 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|