About 4-[(4-aminophenyl)-(4-ethoxy-3-methylphenyl)methyl]-N,2-dimethylaniline
4-[(4-aminophenyl)-(4-ethoxy-3-methylphenyl)methyl]-N,2-dimethylaniline (PubChem CID 14453077) has the molecular formula C24H28N2O
and a molecular weight of 360.50 g/mol. Its IUPAC name is 4-[(4-aminophenyl)-(4-ethoxy-3-methylphenyl)methyl]-N,2-dimethylaniline.
Molecular Properties
| Compound Name | 4-[(4-aminophenyl)-(4-ethoxy-3-methylphenyl)methyl]-N,2-dimethylaniline |
| PubChem CID | 14453077 |
| Molecular Formula | C24H28N2O |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 4-[(4-aminophenyl)-(4-ethoxy-3-methylphenyl)methyl]-N,2-dimethylaniline |
| SMILES | CCOc1ccc(C(c2ccc(N)cc2)c2ccc(NC)c(C)c2)cc1C |
| InChI | InChI=1S/C24H28N2O/c1-5-27-23-13-9-20(15-17(23)3)24(18-6-10-21(25)11-7-18)19-8-12-22(26-4)16(2)14-19/h6-15,24,26H,5,25H2,1-4H3 |
| InChIKey | NVFSJOQDXZRDNH-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4-aminophenyl)-(4-ethoxy-3-methylphenyl)methyl]-N,2-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-aminophenyl)-(4-ethoxy-3-methylphenyl)methyl]-N,2-dimethylaniline?
The IUPAC name of 4-[(4-aminophenyl)-(4-ethoxy-3-methylphenyl)methyl]-N,2-dimethylaniline (CID 14453077) is 4-[(4-aminophenyl)-(4-ethoxy-3-methylphenyl)methyl]-N,2-dimethylaniline.
What is the SMILES notation for 4-[(4-aminophenyl)-(4-ethoxy-3-methylphenyl)methyl]-N,2-dimethylaniline?
The canonical SMILES for 4-[(4-aminophenyl)-(4-ethoxy-3-methylphenyl)methyl]-N,2-dimethylaniline is CCOc1ccc(C(c2ccc(N)cc2)c2ccc(NC)c(C)c2)cc1C.
What is the InChIKey of 4-[(4-aminophenyl)-(4-ethoxy-3-methylphenyl)methyl]-N,2-dimethylaniline?
The InChIKey is NVFSJOQDXZRDNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28N2O/c1-5-27-23-13-9-20(15-17(23)3)24(18-6-10-21(25)11-7-18)19-8-12-22(26-4)16(2)14-19/h6-15,24,26H,5,25H2,1-4H3.
What are the key properties of 4-[(4-aminophenyl)-(4-ethoxy-3-methylphenyl)methyl]-N,2-dimethylaniline?
4-[(4-aminophenyl)-(4-ethoxy-3-methylphenyl)methyl]-N,2-dimethylaniline has a molecular weight of 360.50 g/mol, XLogP of 5.51, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-aminophenyl)-(4-ethoxy-3-methylphenyl)methyl]-N,2-dimethylaniline is sourced from PubChem (CID 14453077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).