C25H46 — CID 144530805
4-(3-ethylcyclobutyl)-4-(3-methylcyclobutyl)-1,2,3,3a,5,6,7,8,9,9a-decahydrocyclopenta[8]annulene;propane (PubChem CID 144530805) has the molecular formula C25H46 and a molecular weight of 346.64 g/mol. Its IUPAC name is 4-(3-ethylcyclobutyl)-4-(3-methylcyclobutyl)-1,2,3,3a,5,6,7,8,9,9a-decahydrocyclopenta[8]annulene;propane.
| Compound Name | 4-(3-ethylcyclobutyl)-4-(3-methylcyclobutyl)-1,2,3,3a,5,6,7,8,9,9a-decahydrocyclopenta[8]annulene;propane |
|---|---|
| PubChem CID | 144530805 |
| Molecular Formula | C25H46 |
| Molecular Weight | 346.64 g/mol |
| Exact Mass | 346.36 |
| IUPAC Name | 4-(3-ethylcyclobutyl)-4-(3-methylcyclobutyl)-1,2,3,3a,5,6,7,8,9,9a-decahydrocyclopenta[8]annulene;propane |
| SMILES | CCC.CCC1CC(C2(C3CC(C)C3)CCCCCC3CCCC32)C1 |
| InChI | InChI=1S/C22H38.C3H8/c1-3-17-14-20(15-17)22(19-12-16(2)13-19)11-6-4-5-8-18-9-7-10-21(18)22;1-3-2/h16-21H,3-15H2,1-2H3;3H2,1-2H3 |
| InChIKey | MQPCHQATDQDHAN-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.64 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |