C14H31N3O4 — CID 144530873
2-acetamidoethyl formate;N-(4-aminopentyl)acetamide;ethane (PubChem CID 144530873) has the molecular formula C14H31N3O4 and a molecular weight of 305.42 g/mol. Its IUPAC name is 2-acetamidoethyl formate;N-(4-aminopentyl)acetamide;ethane.
| Compound Name | 2-acetamidoethyl formate;N-(4-aminopentyl)acetamide;ethane |
|---|---|
| PubChem CID | 144530873 |
| Molecular Formula | C14H31N3O4 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.23 |
| IUPAC Name | 2-acetamidoethyl formate;N-(4-aminopentyl)acetamide;ethane |
| SMILES | CC.CC(=O)NCCCC(C)N.CC(=O)NCCOC=O |
| InChI | InChI=1S/C7H16N2O.C5H9NO3.C2H6/c1-6(8)4-3-5-9-7(2)10;1-5(8)6-2-3-9-4-7;1-2/h6H,3-5,8H2,1-2H3,(H,9,10);4H,2-3H2,1H3,(H,6,8);1-2H3 |
| InChIKey | JTLHZMHYVKVPEV-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|