C38H49NO2 — CID 144531277
2-[(3Z,5E)-6-[4-(N-(4-tert-butylphenyl)-4-propan-2-ylanilino)phenyl]-5-ethylidene-7-methylocta-1,3-dien-2-yl]oxyethanol (PubChem CID 144531277) has the molecular formula C38H49NO2 and a molecular weight of 551.82 g/mol. Its IUPAC name is 2-[(3Z,5E)-6-[4-(N-(4-tert-butylphenyl)-4-propan-2-ylanilino)phenyl]-5-ethylidene-7-methylocta-1,3-dien-2-yl]oxyethanol.
| Compound Name | 2-[(3Z,5E)-6-[4-(N-(4-tert-butylphenyl)-4-propan-2-ylanilino)phenyl]-5-ethylidene-7-methylocta-1,3-dien-2-yl]oxyethanol |
|---|---|
| PubChem CID | 144531277 |
| Molecular Formula | C38H49NO2 |
| Molecular Weight | 551.82 g/mol |
| Exact Mass | 551.38 |
| IUPAC Name | 2-[(3Z,5E)-6-[4-(N-(4-tert-butylphenyl)-4-propan-2-ylanilino)phenyl]-5-ethylidene-7-methylocta-1,3-dien-2-yl]oxyethanol |
| SMILES | C=C(/C=C\C(=C/C)C(c1ccc(N(c2ccc(C(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1)C(C)C)OCCO |
| InChI | InChI=1S/C38H49NO2/c1-10-30(12-11-29(6)41-26-25-40)37(28(4)5)32-15-21-35(22-16-32)39(34-19-13-31(14-20-34)27(2)3)36-23-17-33(18-24-36)38(7,8)9/h10-24,27-28,37,40H,6,25-26H2,1-5,7-9H3/b12-11-,30-10- |
| InChIKey | KQHVXFOQSZFBCM-KEKIQYSISA-N |
| XLogP | 10.34 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.82 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|