About (5-acetyl-3,4-dichloropyrrolo[2,3-b]pyridin-1-yl) thiohypofluorite
(5-acetyl-3,4-dichloropyrrolo[2,3-b]pyridin-1-yl) thiohypofluorite (PubChem CID 144531729) has the molecular formula C9H5Cl2FN2OS
and a molecular weight of 279.12 g/mol. Its IUPAC name is (5-acetyl-3,4-dichloropyrrolo[2,3-b]pyridin-1-yl) thiohypofluorite.
Molecular Properties
| Compound Name | (5-acetyl-3,4-dichloropyrrolo[2,3-b]pyridin-1-yl) thiohypofluorite |
| PubChem CID | 144531729 |
| Molecular Formula | C9H5Cl2FN2OS |
| Molecular Weight | 279.12 g/mol |
| Exact Mass | 277.95 |
| IUPAC Name | (5-acetyl-3,4-dichloropyrrolo[2,3-b]pyridin-1-yl) thiohypofluorite |
| SMILES | CC(=O)c1cnc2c(c(Cl)cn2SF)c1Cl |
| InChI | InChI=1S/C9H5Cl2FN2OS/c1-4(15)5-2-13-9-7(8(5)11)6(10)3-14(9)16-12/h2-3H,1H3 |
| InChIKey | GCCIBDUOHHLJFB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.12 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-acetyl-3,4-dichloropyrrolo[2,3-b]pyridin-1-yl) thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-acetyl-3,4-dichloropyrrolo[2,3-b]pyridin-1-yl) thiohypofluorite?
The IUPAC name of (5-acetyl-3,4-dichloropyrrolo[2,3-b]pyridin-1-yl) thiohypofluorite (CID 144531729) is (5-acetyl-3,4-dichloropyrrolo[2,3-b]pyridin-1-yl) thiohypofluorite.
What is the SMILES notation for (5-acetyl-3,4-dichloropyrrolo[2,3-b]pyridin-1-yl) thiohypofluorite?
The canonical SMILES for (5-acetyl-3,4-dichloropyrrolo[2,3-b]pyridin-1-yl) thiohypofluorite is CC(=O)c1cnc2c(c(Cl)cn2SF)c1Cl.
What is the InChIKey of (5-acetyl-3,4-dichloropyrrolo[2,3-b]pyridin-1-yl) thiohypofluorite?
The InChIKey is GCCIBDUOHHLJFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5Cl2FN2OS/c1-4(15)5-2-13-9-7(8(5)11)6(10)3-14(9)16-12/h2-3H,1H3.
What are the key properties of (5-acetyl-3,4-dichloropyrrolo[2,3-b]pyridin-1-yl) thiohypofluorite?
(5-acetyl-3,4-dichloropyrrolo[2,3-b]pyridin-1-yl) thiohypofluorite has a molecular weight of 279.12 g/mol, XLogP of 3.93, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-acetyl-3,4-dichloropyrrolo[2,3-b]pyridin-1-yl) thiohypofluorite is sourced from PubChem (CID 144531729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).