C21H20N2O4 — CID 144532465
(13E,14Z)-7-ethenoxy-13-ethylidene-14-prop-2-enylidene-5-oxa-1,12-diazatetracyclo[8.7.0.03,8.011,16]heptadeca-9,11,15-triene-2,6-dione (PubChem CID 144532465) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is (13E,14Z)-7-ethenoxy-13-ethylidene-14-prop-2-enylidene-5-oxa-1,12-diazatetracyclo[8.7.0.03,8.011,16]heptadeca-9,11,15-triene-2,6-dione.
| Compound Name | (13E,14Z)-7-ethenoxy-13-ethylidene-14-prop-2-enylidene-5-oxa-1,12-diazatetracyclo[8.7.0.03,8.011,16]heptadeca-9,11,15-triene-2,6-dione |
|---|---|
| PubChem CID | 144532465 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | (13E,14Z)-7-ethenoxy-13-ethylidene-14-prop-2-enylidene-5-oxa-1,12-diazatetracyclo[8.7.0.03,8.011,16]heptadeca-9,11,15-triene-2,6-dione |
| SMILES | C=C/C=c1/cc2c(n/c1=C/C)C1=CC3C(COC(=O)C3OC=C)C(=O)N1C2 |
| InChI | InChI=1S/C21H20N2O4/c1-4-7-12-8-13-10-23-17(18(13)22-16(12)5-2)9-14-15(20(23)24)11-27-21(25)19(14)26-6-3/h4-9,14-15,19H,1,3,10-11H2,2H3/b12-7-,16-5+ |
| InChIKey | OLBRUZLLDRCVNO-UJOHJOKBSA-N |
| XLogP | 0.86 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|