C18H31NO — CID 144532564
ethane;formamide;5-(2-methylpentan-2-yl)-2,3-dihydro-1H-indene (PubChem CID 144532564) has the molecular formula C18H31NO and a molecular weight of 277.45 g/mol. Its IUPAC name is ethane;formamide;5-(2-methylpentan-2-yl)-2,3-dihydro-1H-indene.
| Compound Name | ethane;formamide;5-(2-methylpentan-2-yl)-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 144532564 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | ethane;formamide;5-(2-methylpentan-2-yl)-2,3-dihydro-1H-indene |
| SMILES | CC.CCCC(C)(C)c1ccc2c(c1)CCC2.NC=O |
| InChI | InChI=1S/C15H22.C2H6.CH3NO/c1-4-10-15(2,3)14-9-8-12-6-5-7-13(12)11-14;1-2;2-1-3/h8-9,11H,4-7,10H2,1-3H3;1-2H3;1H,(H2,2,3) |
| InChIKey | VLWKQMDKFKBBNF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|