About N,4-dimethylthiadiazol-5-amine;formic acid
N,4-dimethylthiadiazol-5-amine;formic acid (PubChem CID 144532878) has the molecular formula C5H9N3O2S
and a molecular weight of 175.21 g/mol. Its IUPAC name is N,4-dimethylthiadiazol-5-amine;formic acid.
Molecular Properties
| Compound Name | N,4-dimethylthiadiazol-5-amine;formic acid |
| PubChem CID | 144532878 |
| Molecular Formula | C5H9N3O2S |
| Molecular Weight | 175.21 g/mol |
| Exact Mass | 175.04 |
| IUPAC Name | N,4-dimethylthiadiazol-5-amine;formic acid |
| SMILES | CNc1snnc1C.O=CO |
| InChI | InChI=1S/C4H7N3S.CH2O2/c1-3-4(5-2)8-7-6-3;2-1-3/h5H,1-2H3;1H,(H,2,3) |
| InChIKey | RRJHAGMGGILYFA-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.21 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N,4-dimethylthiadiazol-5-amine;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,4-dimethylthiadiazol-5-amine;formic acid?
The IUPAC name of N,4-dimethylthiadiazol-5-amine;formic acid (CID 144532878) is N,4-dimethylthiadiazol-5-amine;formic acid.
What is the SMILES notation for N,4-dimethylthiadiazol-5-amine;formic acid?
The canonical SMILES for N,4-dimethylthiadiazol-5-amine;formic acid is CNc1snnc1C.O=CO.
What is the InChIKey of N,4-dimethylthiadiazol-5-amine;formic acid?
The InChIKey is RRJHAGMGGILYFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N3S.CH2O2/c1-3-4(5-2)8-7-6-3;2-1-3/h5H,1-2H3;1H,(H,2,3).
What are the key properties of N,4-dimethylthiadiazol-5-amine;formic acid?
N,4-dimethylthiadiazol-5-amine;formic acid has a molecular weight of 175.21 g/mol, XLogP of 0.59, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,4-dimethylthiadiazol-5-amine;formic acid is sourced from PubChem (CID 144532878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).