C28H23ClN4O5 — CID 144532994
1-(2-chlorophenyl)ethyl N-[5-[8-[4-(2,2-dihydroxyethyl)phenyl]quinazolin-5-yl]-1,2-oxazol-4-yl]carbamate (PubChem CID 144532994) has the molecular formula C28H23ClN4O5 and a molecular weight of 530.97 g/mol. Its IUPAC name is 1-(2-chlorophenyl)ethyl N-[5-[8-[4-(2,2-dihydroxyethyl)phenyl]quinazolin-5-yl]-1,2-oxazol-4-yl]carbamate.
| Compound Name | 1-(2-chlorophenyl)ethyl N-[5-[8-[4-(2,2-dihydroxyethyl)phenyl]quinazolin-5-yl]-1,2-oxazol-4-yl]carbamate |
|---|---|
| PubChem CID | 144532994 |
| Molecular Formula | C28H23ClN4O5 |
| Molecular Weight | 530.97 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | 1-(2-chlorophenyl)ethyl N-[5-[8-[4-(2,2-dihydroxyethyl)phenyl]quinazolin-5-yl]-1,2-oxazol-4-yl]carbamate |
| SMILES | CC(OC(=O)Nc1cnoc1-c1ccc(-c2ccc(CC(O)O)cc2)c2ncncc12)c1ccccc1Cl |
| InChI | InChI=1S/C28H23ClN4O5/c1-16(19-4-2-3-5-23(19)29)37-28(36)33-24-14-32-38-27(24)21-11-10-20(26-22(21)13-30-15-31-26)18-8-6-17(7-9-18)12-25(34)35/h2-11,13-16,25,34-35H,12H2,1H3,(H,33,36) |
| InChIKey | NWLGMWMULDIQQR-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 130.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.97 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|