About ethane;4-ethyl-3,5-dimethyl-4H-pyrazole
ethane;4-ethyl-3,5-dimethyl-4H-pyrazole (PubChem CID 144533099) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is ethane;4-ethyl-3,5-dimethyl-4H-pyrazole.
Molecular Properties
| Compound Name | ethane;4-ethyl-3,5-dimethyl-4H-pyrazole |
| PubChem CID | 144533099 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | ethane;4-ethyl-3,5-dimethyl-4H-pyrazole |
| SMILES | CC.CCC1C(C)=NN=C1C |
| InChI | InChI=1S/C7H12N2.C2H6/c1-4-7-5(2)8-9-6(7)3;1-2/h7H,4H2,1-3H3;1-2H3 |
| InChIKey | YUKYTYWNCAPUGR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;4-ethyl-3,5-dimethyl-4H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-ethyl-3,5-dimethyl-4H-pyrazole?
The IUPAC name of ethane;4-ethyl-3,5-dimethyl-4H-pyrazole (CID 144533099) is ethane;4-ethyl-3,5-dimethyl-4H-pyrazole.
What is the SMILES notation for ethane;4-ethyl-3,5-dimethyl-4H-pyrazole?
The canonical SMILES for ethane;4-ethyl-3,5-dimethyl-4H-pyrazole is CC.CCC1C(C)=NN=C1C.
What is the InChIKey of ethane;4-ethyl-3,5-dimethyl-4H-pyrazole?
The InChIKey is YUKYTYWNCAPUGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2.C2H6/c1-4-7-5(2)8-9-6(7)3;1-2/h7H,4H2,1-3H3;1-2H3.
What are the key properties of ethane;4-ethyl-3,5-dimethyl-4H-pyrazole?
ethane;4-ethyl-3,5-dimethyl-4H-pyrazole has a molecular weight of 154.26 g/mol, XLogP of 2.89, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-ethyl-3,5-dimethyl-4H-pyrazole is sourced from PubChem (CID 144533099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).