About CID 144533118
CID 144533118 (PubChem CID 144533118) has the molecular formula C9H6BNO2
and a molecular weight of 170.96 g/mol.
Molecular Properties
| Compound Name | CID 144533118 |
| PubChem CID | 144533118 |
| Molecular Formula | C9H6BNO2 |
| Molecular Weight | 170.96 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | — |
| SMILES | [B]N1C(=O)c2ccc(C)cc2C1=O |
| InChI | InChI=1S/C9H6BNO2/c1-5-2-3-6-7(4-5)9(13)11(10)8(6)12/h2-4H,1H3 |
| InChIKey | SVOFZLQPINBHPH-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.96 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze CID 144533118 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 144533118?
The IUPAC name of CID 144533118 (CID 144533118) is not available.
What is the SMILES notation for CID 144533118?
The canonical SMILES for CID 144533118 is [B]N1C(=O)c2ccc(C)cc2C1=O.
What is the InChIKey of CID 144533118?
The InChIKey is SVOFZLQPINBHPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6BNO2/c1-5-2-3-6-7(4-5)9(13)11(10)8(6)12/h2-4H,1H3.
What are the key properties of CID 144533118?
CID 144533118 has a molecular weight of 170.96 g/mol, XLogP of 0.67, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 144533118 is sourced from PubChem (CID 144533118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).