C20H38N2S2 — CID 144533508
2,5-dimethyl-[1,3]thiazolo[5,4-d][1,3]thiazole;bis(heptane) (PubChem CID 144533508) has the molecular formula C20H38N2S2 and a molecular weight of 370.67 g/mol. Its IUPAC name is 2,5-dimethyl-[1,3]thiazolo[5,4-d][1,3]thiazole;bis(heptane).
| Compound Name | 2,5-dimethyl-[1,3]thiazolo[5,4-d][1,3]thiazole;bis(heptane) |
|---|---|
| PubChem CID | 144533508 |
| Molecular Formula | C20H38N2S2 |
| Molecular Weight | 370.67 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | 2,5-dimethyl-[1,3]thiazolo[5,4-d][1,3]thiazole;bis(heptane) |
| SMILES | CCCCCCC.CCCCCCC.Cc1nc2sc(C)nc2s1 |
| InChI | InChI=1S/2C7H16.C6H6N2S2/c2*1-3-5-7-6-4-2;1-3-7-5-6(9-3)8-4(2)10-5/h2*3-7H2,1-2H3;1-2H3 |
| InChIKey | GFSPTAYQLSDWFV-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.67 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|