C16H25NO2 — CID 144533516
(3Z)-N,2-dimethylpenta-1,3-dien-3-amine;[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl] formate (PubChem CID 144533516) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is (3Z)-N,2-dimethylpenta-1,3-dien-3-amine;[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl] formate.
| Compound Name | (3Z)-N,2-dimethylpenta-1,3-dien-3-amine;[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl] formate |
|---|---|
| PubChem CID | 144533516 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | (3Z)-N,2-dimethylpenta-1,3-dien-3-amine;[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl] formate |
| SMILES | C=C(C)/C(=C/C)NC.C=C/C=C(\C=C/C)COC=O |
| InChI | InChI=1S/C9H12O2.C7H13N/c1-3-5-9(6-4-2)7-11-8-10;1-5-7(8-4)6(2)3/h3-6,8H,1,7H2,2H3;5,8H,2H2,1,3-4H3/b6-4-,9-5+;7-5- |
| InChIKey | HRXCAAGUGYGSDX-FEZDZOALSA-N |
| XLogP | 3.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|