About [3-methyl-5-[4-[4-(2-methylpyrrolidin-1-yl)phenyl]phenyl]-1,2-oxazol-4-yl]carbamic acid
[3-methyl-5-[4-[4-(2-methylpyrrolidin-1-yl)phenyl]phenyl]-1,2-oxazol-4-yl]carbamic acid (PubChem CID 144533546) has the molecular formula C22H23N3O3
and a molecular weight of 377.44 g/mol. Its IUPAC name is [3-methyl-5-[4-[4-(2-methylpyrrolidin-1-yl)phenyl]phenyl]-1,2-oxazol-4-yl]carbamic acid.
Molecular Properties
| Compound Name | [3-methyl-5-[4-[4-(2-methylpyrrolidin-1-yl)phenyl]phenyl]-1,2-oxazol-4-yl]carbamic acid |
| PubChem CID | 144533546 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | [3-methyl-5-[4-[4-(2-methylpyrrolidin-1-yl)phenyl]phenyl]-1,2-oxazol-4-yl]carbamic acid |
| SMILES | Cc1noc(-c2ccc(-c3ccc(N4CCCC4C)cc3)cc2)c1NC(=O)O |
| InChI | InChI=1S/C22H23N3O3/c1-14-4-3-13-25(14)19-11-9-17(10-12-19)16-5-7-18(8-6-16)21-20(23-22(26)27)15(2)24-28-21/h5-12,14,23H,3-4,13H2,1-2H3,(H,26,27) |
| InChIKey | JGHAEUMCXGMYRI-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 78.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-methyl-5-[4-[4-(2-methylpyrrolidin-1-yl)phenyl]phenyl]-1,2-oxazol-4-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-methyl-5-[4-[4-(2-methylpyrrolidin-1-yl)phenyl]phenyl]-1,2-oxazol-4-yl]carbamic acid?
The IUPAC name of [3-methyl-5-[4-[4-(2-methylpyrrolidin-1-yl)phenyl]phenyl]-1,2-oxazol-4-yl]carbamic acid (CID 144533546) is [3-methyl-5-[4-[4-(2-methylpyrrolidin-1-yl)phenyl]phenyl]-1,2-oxazol-4-yl]carbamic acid.
What is the SMILES notation for [3-methyl-5-[4-[4-(2-methylpyrrolidin-1-yl)phenyl]phenyl]-1,2-oxazol-4-yl]carbamic acid?
The canonical SMILES for [3-methyl-5-[4-[4-(2-methylpyrrolidin-1-yl)phenyl]phenyl]-1,2-oxazol-4-yl]carbamic acid is Cc1noc(-c2ccc(-c3ccc(N4CCCC4C)cc3)cc2)c1NC(=O)O.
What is the InChIKey of [3-methyl-5-[4-[4-(2-methylpyrrolidin-1-yl)phenyl]phenyl]-1,2-oxazol-4-yl]carbamic acid?
The InChIKey is JGHAEUMCXGMYRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N3O3/c1-14-4-3-13-25(14)19-11-9-17(10-12-19)16-5-7-18(8-6-16)21-20(23-22(26)27)15(2)24-28-21/h5-12,14,23H,3-4,13H2,1-2H3,(H,26,27).
What are the key properties of [3-methyl-5-[4-[4-(2-methylpyrrolidin-1-yl)phenyl]phenyl]-1,2-oxazol-4-yl]carbamic acid?
[3-methyl-5-[4-[4-(2-methylpyrrolidin-1-yl)phenyl]phenyl]-1,2-oxazol-4-yl]carbamic acid has a molecular weight of 377.44 g/mol, XLogP of 5.40, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-methyl-5-[4-[4-(2-methylpyrrolidin-1-yl)phenyl]phenyl]-1,2-oxazol-4-yl]carbamic acid is sourced from PubChem (CID 144533546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).