About 5-[4-[4-(1-methoxycarbonylcyclopropyl)phenyl]phenyl]-3-methyl-1,2-thiazole-4-carboxylic acid
5-[4-[4-(1-methoxycarbonylcyclopropyl)phenyl]phenyl]-3-methyl-1,2-thiazole-4-carboxylic acid (PubChem CID 144533911) has the molecular formula C22H19NO4S
and a molecular weight of 393.46 g/mol. Its IUPAC name is 5-[4-[4-(1-methoxycarbonylcyclopropyl)phenyl]phenyl]-3-methyl-1,2-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-[4-[4-(1-methoxycarbonylcyclopropyl)phenyl]phenyl]-3-methyl-1,2-thiazole-4-carboxylic acid |
| PubChem CID | 144533911 |
| Molecular Formula | C22H19NO4S |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 5-[4-[4-(1-methoxycarbonylcyclopropyl)phenyl]phenyl]-3-methyl-1,2-thiazole-4-carboxylic acid |
| SMILES | COC(=O)C1(c2ccc(-c3ccc(-c4snc(C)c4C(=O)O)cc3)cc2)CC1 |
| InChI | InChI=1S/C22H19NO4S/c1-13-18(20(24)25)19(28-23-13)16-5-3-14(4-6-16)15-7-9-17(10-8-15)22(11-12-22)21(26)27-2/h3-10H,11-12H2,1-2H3,(H,24,25) |
| InChIKey | ZWNYCZUBYKZTTG-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[4-[4-(1-methoxycarbonylcyclopropyl)phenyl]phenyl]-3-methyl-1,2-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-[4-(1-methoxycarbonylcyclopropyl)phenyl]phenyl]-3-methyl-1,2-thiazole-4-carboxylic acid?
The IUPAC name of 5-[4-[4-(1-methoxycarbonylcyclopropyl)phenyl]phenyl]-3-methyl-1,2-thiazole-4-carboxylic acid (CID 144533911) is 5-[4-[4-(1-methoxycarbonylcyclopropyl)phenyl]phenyl]-3-methyl-1,2-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-[4-[4-(1-methoxycarbonylcyclopropyl)phenyl]phenyl]-3-methyl-1,2-thiazole-4-carboxylic acid?
The canonical SMILES for 5-[4-[4-(1-methoxycarbonylcyclopropyl)phenyl]phenyl]-3-methyl-1,2-thiazole-4-carboxylic acid is COC(=O)C1(c2ccc(-c3ccc(-c4snc(C)c4C(=O)O)cc3)cc2)CC1.
What is the InChIKey of 5-[4-[4-(1-methoxycarbonylcyclopropyl)phenyl]phenyl]-3-methyl-1,2-thiazole-4-carboxylic acid?
The InChIKey is ZWNYCZUBYKZTTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19NO4S/c1-13-18(20(24)25)19(28-23-13)16-5-3-14(4-6-16)15-7-9-17(10-8-15)22(11-12-22)21(26)27-2/h3-10H,11-12H2,1-2H3,(H,24,25).
What are the key properties of 5-[4-[4-(1-methoxycarbonylcyclopropyl)phenyl]phenyl]-3-methyl-1,2-thiazole-4-carboxylic acid?
5-[4-[4-(1-methoxycarbonylcyclopropyl)phenyl]phenyl]-3-methyl-1,2-thiazole-4-carboxylic acid has a molecular weight of 393.46 g/mol, XLogP of 4.69, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-[4-(1-methoxycarbonylcyclopropyl)phenyl]phenyl]-3-methyl-1,2-thiazole-4-carboxylic acid is sourced from PubChem (CID 144533911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).