About 4,5-bis(prop-1-en-2-yl)-1,3-oxazole;ethane
4,5-bis(prop-1-en-2-yl)-1,3-oxazole;ethane (PubChem CID 144533937) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is 4,5-bis(prop-1-en-2-yl)-1,3-oxazole;ethane.
Molecular Properties
| Compound Name | 4,5-bis(prop-1-en-2-yl)-1,3-oxazole;ethane |
| PubChem CID | 144533937 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 4,5-bis(prop-1-en-2-yl)-1,3-oxazole;ethane |
| SMILES | C=C(C)c1ncoc1C(=C)C.CC |
| InChI | InChI=1S/C9H11NO.C2H6/c1-6(2)8-9(7(3)4)11-5-10-8;1-2/h5H,1,3H2,2,4H3;1-2H3 |
| InChIKey | IAPGHGSMFAQCQF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5-bis(prop-1-en-2-yl)-1,3-oxazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(prop-1-en-2-yl)-1,3-oxazole;ethane?
The IUPAC name of 4,5-bis(prop-1-en-2-yl)-1,3-oxazole;ethane (CID 144533937) is 4,5-bis(prop-1-en-2-yl)-1,3-oxazole;ethane.
What is the SMILES notation for 4,5-bis(prop-1-en-2-yl)-1,3-oxazole;ethane?
The canonical SMILES for 4,5-bis(prop-1-en-2-yl)-1,3-oxazole;ethane is C=C(C)c1ncoc1C(=C)C.CC.
What is the InChIKey of 4,5-bis(prop-1-en-2-yl)-1,3-oxazole;ethane?
The InChIKey is IAPGHGSMFAQCQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO.C2H6/c1-6(2)8-9(7(3)4)11-5-10-8;1-2/h5H,1,3H2,2,4H3;1-2H3.
What are the key properties of 4,5-bis(prop-1-en-2-yl)-1,3-oxazole;ethane?
4,5-bis(prop-1-en-2-yl)-1,3-oxazole;ethane has a molecular weight of 179.26 g/mol, XLogP of 3.77, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(prop-1-en-2-yl)-1,3-oxazole;ethane is sourced from PubChem (CID 144533937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).