About 2-amino-2-(fluoromethyl)-7,8,8-trimethylnonan-1-ol
2-amino-2-(fluoromethyl)-7,8,8-trimethylnonan-1-ol (PubChem CID 144535652) has the molecular formula C13H28FNO
and a molecular weight of 233.37 g/mol. Its IUPAC name is 2-amino-2-(fluoromethyl)-7,8,8-trimethylnonan-1-ol.
Molecular Properties
| Compound Name | 2-amino-2-(fluoromethyl)-7,8,8-trimethylnonan-1-ol |
| PubChem CID | 144535652 |
| Molecular Formula | C13H28FNO |
| Molecular Weight | 233.37 g/mol |
| Exact Mass | 233.22 |
| IUPAC Name | 2-amino-2-(fluoromethyl)-7,8,8-trimethylnonan-1-ol |
| SMILES | CC(CCCCC(N)(CO)CF)C(C)(C)C |
| InChI | InChI=1S/C13H28FNO/c1-11(12(2,3)4)7-5-6-8-13(15,9-14)10-16/h11,16H,5-10,15H2,1-4H3 |
| InChIKey | QYEYCBGYGWHFNW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-2-(fluoromethyl)-7,8,8-trimethylnonan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-(fluoromethyl)-7,8,8-trimethylnonan-1-ol?
The IUPAC name of 2-amino-2-(fluoromethyl)-7,8,8-trimethylnonan-1-ol (CID 144535652) is 2-amino-2-(fluoromethyl)-7,8,8-trimethylnonan-1-ol.
What is the SMILES notation for 2-amino-2-(fluoromethyl)-7,8,8-trimethylnonan-1-ol?
The canonical SMILES for 2-amino-2-(fluoromethyl)-7,8,8-trimethylnonan-1-ol is CC(CCCCC(N)(CO)CF)C(C)(C)C.
What is the InChIKey of 2-amino-2-(fluoromethyl)-7,8,8-trimethylnonan-1-ol?
The InChIKey is QYEYCBGYGWHFNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28FNO/c1-11(12(2,3)4)7-5-6-8-13(15,9-14)10-16/h11,16H,5-10,15H2,1-4H3.
What are the key properties of 2-amino-2-(fluoromethyl)-7,8,8-trimethylnonan-1-ol?
2-amino-2-(fluoromethyl)-7,8,8-trimethylnonan-1-ol has a molecular weight of 233.37 g/mol, XLogP of 2.89, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-(fluoromethyl)-7,8,8-trimethylnonan-1-ol is sourced from PubChem (CID 144535652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).