C18H26O6 — CID 144536088
1-[(7R)-1,2,3-trimethoxy-5-(methoxymethoxy)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-yl]ethanone (PubChem CID 144536088) has the molecular formula C18H26O6 and a molecular weight of 338.40 g/mol. Its IUPAC name is 1-[(7R)-1,2,3-trimethoxy-5-(methoxymethoxy)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-yl]ethanone.
| Compound Name | 1-[(7R)-1,2,3-trimethoxy-5-(methoxymethoxy)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-yl]ethanone |
|---|---|
| PubChem CID | 144536088 |
| Molecular Formula | C18H26O6 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 1-[(7R)-1,2,3-trimethoxy-5-(methoxymethoxy)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-yl]ethanone |
| SMILES | COCOC1C[C@H](C(C)=O)CCc2c1cc(OC)c(OC)c2OC |
| InChI | InChI=1S/C18H26O6/c1-11(19)12-6-7-13-14(15(8-12)24-10-20-2)9-16(21-3)18(23-5)17(13)22-4/h9,12,15H,6-8,10H2,1-5H3/t12-,15?/m1/s1 |
| InChIKey | FEOWZSKKVYIBMI-KEKZHRQWSA-N |
| XLogP | 2.92 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|