C24H27F3N4O3 — CID 144536340
(4S)-3-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-2-(2-methylpropyl)-4-[[3-(trifluoromethoxy)anilino]oxymethyl]-3,4-dihydroisoquinolin-1-one (PubChem CID 144536340) has the molecular formula C24H27F3N4O3 and a molecular weight of 476.50 g/mol. Its IUPAC name is (4S)-3-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-2-(2-methylpropyl)-4-[[3-(trifluoromethoxy)anilino]oxymethyl]-3,4-dihydroisoquinolin-1-one.
| Compound Name | (4S)-3-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-2-(2-methylpropyl)-4-[[3-(trifluoromethoxy)anilino]oxymethyl]-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 144536340 |
| Molecular Formula | C24H27F3N4O3 |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | (4S)-3-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-2-(2-methylpropyl)-4-[[3-(trifluoromethoxy)anilino]oxymethyl]-3,4-dihydroisoquinolin-1-one |
| SMILES | [H]/N=C/C(=C\N)C1[C@@H](CONc2cccc(OC(F)(F)F)c2)c2ccccc2C(=O)N1CC(C)C |
| InChI | InChI=1S/C24H27F3N4O3/c1-15(2)13-31-22(16(11-28)12-29)21(19-8-3-4-9-20(19)23(31)32)14-33-30-17-6-5-7-18(10-17)34-24(25,26)27/h3-12,15,21-22,28,30H,13-14,29H2,1-2H3/b16-12+,28-11+/t21-,22?/m0/s1 |
| InChIKey | VYOWKFIESQNNPS-SYZCHPFUSA-N |
| XLogP | 4.69 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|