C25H24F2N6O3 — CID 144537135
1-[2-(difluoromethoxy)-4-[ethenyl-(methylideneamino)amino]phenyl]-3-[2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]pyrazol-3-yl]-5-methoxypyridazin-4-one (PubChem CID 144537135) has the molecular formula C25H24F2N6O3 and a molecular weight of 494.50 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)-4-[ethenyl-(methylideneamino)amino]phenyl]-3-[2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]pyrazol-3-yl]-5-methoxypyridazin-4-one.
| Compound Name | 1-[2-(difluoromethoxy)-4-[ethenyl-(methylideneamino)amino]phenyl]-3-[2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]pyrazol-3-yl]-5-methoxypyridazin-4-one |
|---|---|
| PubChem CID | 144537135 |
| Molecular Formula | C25H24F2N6O3 |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | 1-[2-(difluoromethoxy)-4-[ethenyl-(methylideneamino)amino]phenyl]-3-[2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]pyrazol-3-yl]-5-methoxypyridazin-4-one |
| SMILES | C=C/C(=C\C=C/C)n1nccc1-c1nn(-c2ccc(N(C=C)N=C)cc2OC(F)F)cc(OC)c1=O |
| InChI | InChI=1S/C25H24F2N6O3/c1-6-9-10-17(7-2)33-20(13-14-29-33)23-24(34)22(35-5)16-32(30-23)19-12-11-18(31(8-3)28-4)15-21(19)36-25(26)27/h6-16,25H,2-4H2,1,5H3/b9-6-,17-10+ |
| InChIKey | QWAGETVHDSGNAX-KGONRHBGSA-N |
| XLogP | 4.87 |
| TPSA | 86.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|