C24H36O3 — CID 144537351
5,5',10,13-tetramethylspiro[1,2,3,4,6,7,8,14,15,16-decahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxane]-12-one (PubChem CID 144537351) has the molecular formula C24H36O3 and a molecular weight of 372.55 g/mol. Its IUPAC name is 5,5',10,13-tetramethylspiro[1,2,3,4,6,7,8,14,15,16-decahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxane]-12-one.
| Compound Name | 5,5',10,13-tetramethylspiro[1,2,3,4,6,7,8,14,15,16-decahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxane]-12-one |
|---|---|
| PubChem CID | 144537351 |
| Molecular Formula | C24H36O3 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | 5,5',10,13-tetramethylspiro[1,2,3,4,6,7,8,14,15,16-decahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxane]-12-one |
| SMILES | CC1COC2(CCC3C4CCC5(C)CCCCC5(C)C4=CC(=O)C32C)OC1 |
| InChI | InChI=1S/C24H36O3/c1-16-14-26-24(27-15-16)12-8-18-17-7-11-21(2)9-5-6-10-22(21,3)19(17)13-20(25)23(18,24)4/h13,16-18H,5-12,14-15H2,1-4H3 |
| InChIKey | HMJWRAJNHHBGPG-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |