C18H31NO — CID 144537427
4-[(E)-2,6,7-trimethyloct-5-en-2-yl]cyclohex-3-ene-1-carboxamide (PubChem CID 144537427) has the molecular formula C18H31NO and a molecular weight of 277.45 g/mol. Its IUPAC name is 4-[(E)-2,6,7-trimethyloct-5-en-2-yl]cyclohex-3-ene-1-carboxamide.
| Compound Name | 4-[(E)-2,6,7-trimethyloct-5-en-2-yl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 144537427 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | 4-[(E)-2,6,7-trimethyloct-5-en-2-yl]cyclohex-3-ene-1-carboxamide |
| SMILES | C/C(=C\CCC(C)(C)C1=CCC(C(N)=O)CC1)C(C)C |
| InChI | InChI=1S/C18H31NO/c1-13(2)14(3)7-6-12-18(4,5)16-10-8-15(9-11-16)17(19)20/h7,10,13,15H,6,8-9,11-12H2,1-5H3,(H2,19,20)/b14-7+ |
| InChIKey | WDEDNMZZMIZCQZ-VGOFMYFVSA-N |
| XLogP | 4.61 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|