C26H26N4O — CID 144538057
12-[3-[(dimethylamino)methyl]phenyl]-7-methyl-11-phenyl-2,3,10-triazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8-tetraen-4-one (PubChem CID 144538057) has the molecular formula C26H26N4O and a molecular weight of 410.52 g/mol. Its IUPAC name is 12-[3-[(dimethylamino)methyl]phenyl]-7-methyl-11-phenyl-2,3,10-triazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8-tetraen-4-one.
| Compound Name | 12-[3-[(dimethylamino)methyl]phenyl]-7-methyl-11-phenyl-2,3,10-triazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8-tetraen-4-one |
|---|---|
| PubChem CID | 144538057 |
| Molecular Formula | C26H26N4O |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 12-[3-[(dimethylamino)methyl]phenyl]-7-methyl-11-phenyl-2,3,10-triazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8-tetraen-4-one |
| SMILES | Cc1cc2c3c(n[nH]c(=O)c3c1)C(c1cccc(CN(C)C)c1)C(c1ccccc1)N2 |
| InChI | InChI=1S/C26H26N4O/c1-16-12-20-23-21(13-16)27-24(18-9-5-4-6-10-18)22(25(23)28-29-26(20)31)19-11-7-8-17(14-19)15-30(2)3/h4-14,22,24,27H,15H2,1-3H3,(H,29,31) |
| InChIKey | AQGWGBVNVMRERO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |