C21H29N9O10 — CID 144538499
(2S)-2-[[(2S)-2-carboxy-6-[[2-[4-[(2-nitroimidazol-1-yl)methyl]triazol-1-yl]acetyl]amino]hexan-2-yl]carbamoylamino]pentanedioic acid (PubChem CID 144538499) has the molecular formula C21H29N9O10 and a molecular weight of 567.52 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-carboxy-6-[[2-[4-[(2-nitroimidazol-1-yl)methyl]triazol-1-yl]acetyl]amino]hexan-2-yl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[(2S)-2-carboxy-6-[[2-[4-[(2-nitroimidazol-1-yl)methyl]triazol-1-yl]acetyl]amino]hexan-2-yl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 144538499 |
| Molecular Formula | C21H29N9O10 |
| Molecular Weight | 567.52 g/mol |
| Exact Mass | 567.20 |
| IUPAC Name | (2S)-2-[[(2S)-2-carboxy-6-[[2-[4-[(2-nitroimidazol-1-yl)methyl]triazol-1-yl]acetyl]amino]hexan-2-yl]carbamoylamino]pentanedioic acid |
| SMILES | C[C@@](CCCCNC(=O)Cn1cc(Cn2ccnc2[N+](=O)[O-])nn1)(NC(=O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C21H29N9O10/c1-21(18(36)37,25-19(38)24-14(17(34)35)4-5-16(32)33)6-2-3-7-22-15(31)12-29-11-13(26-27-29)10-28-9-8-23-20(28)30(39)40/h8-9,11,14H,2-7,10,12H2,1H3,(H,22,31)(H,32,33)(H,34,35)(H,36,37)(H2,24,25,38)/t14-,21-/m0/s1 |
| InChIKey | OWVXKNCPPFIPHI-QKKBWIMNSA-N |
| XLogP | -0.82 |
| TPSA | 273.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.52 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|