About [(Z)-4-amino-5-[amino(2-oxoethyl)amino]pent-4-enyl] thiohypofluorite;propan-2-amine
[(Z)-4-amino-5-[amino(2-oxoethyl)amino]pent-4-enyl] thiohypofluorite;propan-2-amine (PubChem CID 144538545) has the molecular formula C10H23FN4OS
and a molecular weight of 266.39 g/mol. Its IUPAC name is [(Z)-4-amino-5-[amino(2-oxoethyl)amino]pent-4-enyl] thiohypofluorite;propan-2-amine.
Molecular Properties
| Compound Name | [(Z)-4-amino-5-[amino(2-oxoethyl)amino]pent-4-enyl] thiohypofluorite;propan-2-amine |
| PubChem CID | 144538545 |
| Molecular Formula | C10H23FN4OS |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | [(Z)-4-amino-5-[amino(2-oxoethyl)amino]pent-4-enyl] thiohypofluorite;propan-2-amine |
| SMILES | CC(C)N.N/C(=C\N(N)CC=O)CCCSF |
| InChI | InChI=1S/C7H14FN3OS.C3H9N/c8-13-5-1-2-7(9)6-11(10)3-4-12;1-3(2)4/h4,6H,1-3,5,9-10H2;3H,4H2,1-2H3/b7-6-; |
| InChIKey | ZWECFDFCAXNTMT-NAFXZHHSSA-N |
| XLogP | 0.91 |
| TPSA | 98.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-4-amino-5-[amino(2-oxoethyl)amino]pent-4-enyl] thiohypofluorite;propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-4-amino-5-[amino(2-oxoethyl)amino]pent-4-enyl] thiohypofluorite;propan-2-amine?
The IUPAC name of [(Z)-4-amino-5-[amino(2-oxoethyl)amino]pent-4-enyl] thiohypofluorite;propan-2-amine (CID 144538545) is [(Z)-4-amino-5-[amino(2-oxoethyl)amino]pent-4-enyl] thiohypofluorite;propan-2-amine.
What is the SMILES notation for [(Z)-4-amino-5-[amino(2-oxoethyl)amino]pent-4-enyl] thiohypofluorite;propan-2-amine?
The canonical SMILES for [(Z)-4-amino-5-[amino(2-oxoethyl)amino]pent-4-enyl] thiohypofluorite;propan-2-amine is CC(C)N.N/C(=C\N(N)CC=O)CCCSF.
What is the InChIKey of [(Z)-4-amino-5-[amino(2-oxoethyl)amino]pent-4-enyl] thiohypofluorite;propan-2-amine?
The InChIKey is ZWECFDFCAXNTMT-NAFXZHHSSA-N. The full InChI is InChI=1S/C7H14FN3OS.C3H9N/c8-13-5-1-2-7(9)6-11(10)3-4-12;1-3(2)4/h4,6H,1-3,5,9-10H2;3H,4H2,1-2H3/b7-6-;.
What are the key properties of [(Z)-4-amino-5-[amino(2-oxoethyl)amino]pent-4-enyl] thiohypofluorite;propan-2-amine?
[(Z)-4-amino-5-[amino(2-oxoethyl)amino]pent-4-enyl] thiohypofluorite;propan-2-amine has a molecular weight of 266.39 g/mol, XLogP of 0.91, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-4-amino-5-[amino(2-oxoethyl)amino]pent-4-enyl] thiohypofluorite;propan-2-amine is sourced from PubChem (CID 144538545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).