C23H35FN6O10 — CID 144538619
6-[[2-[5-(3-fluoropropyl)-2-methyl-1H-triazol-3-yl]acetyl]amino]hexanoic acid;(2S)-2-(2,4,6-trioxo-1,3-diazinan-1-yl)pentanedioic acid (PubChem CID 144538619) has the molecular formula C23H35FN6O10 and a molecular weight of 574.56 g/mol. Its IUPAC name is 6-[[2-[5-(3-fluoropropyl)-2-methyl-1H-triazol-3-yl]acetyl]amino]hexanoic acid;(2S)-2-(2,4,6-trioxo-1,3-diazinan-1-yl)pentanedioic acid.
| Compound Name | 6-[[2-[5-(3-fluoropropyl)-2-methyl-1H-triazol-3-yl]acetyl]amino]hexanoic acid;(2S)-2-(2,4,6-trioxo-1,3-diazinan-1-yl)pentanedioic acid |
|---|---|
| PubChem CID | 144538619 |
| Molecular Formula | C23H35FN6O10 |
| Molecular Weight | 574.56 g/mol |
| Exact Mass | 574.24 |
| IUPAC Name | 6-[[2-[5-(3-fluoropropyl)-2-methyl-1H-triazol-3-yl]acetyl]amino]hexanoic acid;(2S)-2-(2,4,6-trioxo-1,3-diazinan-1-yl)pentanedioic acid |
| SMILES | CN1NC(CCCF)=CN1CC(=O)NCCCCCC(=O)O.O=C(O)CC[C@@H](C(=O)O)N1C(=O)CC(=O)NC1=O |
| InChI | InChI=1S/C14H25FN4O3.C9H10N2O7/c1-18-17-12(6-5-8-15)10-19(18)11-13(20)16-9-4-2-3-7-14(21)22;12-5-3-6(13)11(9(18)10-5)4(8(16)17)1-2-7(14)15/h10,17H,2-9,11H2,1H3,(H,16,20)(H,21,22);4H,1-3H2,(H,14,15)(H,16,17)(H,10,12,18)/t;4-/m.0/s1 |
| InChIKey | HPXPKKZWSNMEKW-VWMHFEHESA-N |
| XLogP | -0.22 |
| TPSA | 225.99 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.56 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|