C21H27N5O5S — CID 144539063
(3aR,6S,7R,7aR)-2-ethylimino-2'-[4-[[3-(1-hydroxyethyl)phenoxy]methyl]triazol-1-yl]spiro[3a,6,7,7a-tetrahydro-1H-pyrano[3,2-d][1,3]thiazole-5,1'-cyclopropane]-6,7-diol (PubChem CID 144539063) has the molecular formula C21H27N5O5S and a molecular weight of 461.54 g/mol. Its IUPAC name is (3aR,6S,7R,7aR)-2-ethylimino-2'-[4-[[3-(1-hydroxyethyl)phenoxy]methyl]triazol-1-yl]spiro[3a,6,7,7a-tetrahydro-1H-pyrano[3,2-d][1,3]thiazole-5,1'-cyclopropane]-6,7-diol.
| Compound Name | (3aR,6S,7R,7aR)-2-ethylimino-2'-[4-[[3-(1-hydroxyethyl)phenoxy]methyl]triazol-1-yl]spiro[3a,6,7,7a-tetrahydro-1H-pyrano[3,2-d][1,3]thiazole-5,1'-cyclopropane]-6,7-diol |
|---|---|
| PubChem CID | 144539063 |
| Molecular Formula | C21H27N5O5S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | (3aR,6S,7R,7aR)-2-ethylimino-2'-[4-[[3-(1-hydroxyethyl)phenoxy]methyl]triazol-1-yl]spiro[3a,6,7,7a-tetrahydro-1H-pyrano[3,2-d][1,3]thiazole-5,1'-cyclopropane]-6,7-diol |
| SMILES | CC/N=C1/N[C@@H]2[C@@H](O)[C@H](O)C3(CC3n3cc(COc4cccc(C(C)O)c4)nn3)O[C@@H]2S1 |
| InChI | InChI=1S/C21H27N5O5S/c1-3-22-20-23-16-17(28)18(29)21(31-19(16)32-20)8-15(21)26-9-13(24-25-26)10-30-14-6-4-5-12(7-14)11(2)27/h4-7,9,11,15-19,27-29H,3,8,10H2,1-2H3,(H,22,23)/t11?,15?,16-,17-,18+,19-,21?/m1/s1 |
| InChIKey | IVFQGMNIWCOXNE-SFMURURWSA-N |
| XLogP | 0.75 |
| TPSA | 134.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|