C17H23N3O4 — CID 144539082
2-[[4-[[4-(1-hydroxyethyl)phenoxy]methyl]triazol-1-yl]methyl]oxan-4-ol (PubChem CID 144539082) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is 2-[[4-[[4-(1-hydroxyethyl)phenoxy]methyl]triazol-1-yl]methyl]oxan-4-ol.
| Compound Name | 2-[[4-[[4-(1-hydroxyethyl)phenoxy]methyl]triazol-1-yl]methyl]oxan-4-ol |
|---|---|
| PubChem CID | 144539082 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 2-[[4-[[4-(1-hydroxyethyl)phenoxy]methyl]triazol-1-yl]methyl]oxan-4-ol |
| SMILES | CC(O)c1ccc(OCc2cn(CC3CC(O)CCO3)nn2)cc1 |
| InChI | InChI=1S/C17H23N3O4/c1-12(21)13-2-4-16(5-3-13)24-11-14-9-20(19-18-14)10-17-8-15(22)6-7-23-17/h2-5,9,12,15,17,21-22H,6-8,10-11H2,1H3 |
| InChIKey | BOWSIYHKEPFCOY-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |