C10H19NO2 — CID 144539534
(3aS)-3a-methyl-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[b]pyrrole-2-carbaldehyde;methanol (PubChem CID 144539534) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is (3aS)-3a-methyl-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[b]pyrrole-2-carbaldehyde;methanol.
| Compound Name | (3aS)-3a-methyl-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[b]pyrrole-2-carbaldehyde;methanol |
|---|---|
| PubChem CID | 144539534 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | (3aS)-3a-methyl-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[b]pyrrole-2-carbaldehyde;methanol |
| SMILES | CO.C[C@@]12CCCC1NC(C=O)C2 |
| InChI | InChI=1S/C9H15NO.CH4O/c1-9-4-2-3-8(9)10-7(5-9)6-11;1-2/h6-8,10H,2-5H2,1H3;2H,1H3/t7?,8?,9-;/m0./s1 |
| InChIKey | JCLHAJXRESHYAK-BUJNUYNZSA-N |
| XLogP | 0.71 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|