About 6-methyl-3-oxa-6-azabicyclo[8.5.0]pentadeca-1(10),11,14-triene
6-methyl-3-oxa-6-azabicyclo[8.5.0]pentadeca-1(10),11,14-triene (PubChem CID 144539743) has the molecular formula C14H21NO
and a molecular weight of 219.33 g/mol. Its IUPAC name is 6-methyl-3-oxa-6-azabicyclo[8.5.0]pentadeca-1(10),11,14-triene.
Molecular Properties
| Compound Name | 6-methyl-3-oxa-6-azabicyclo[8.5.0]pentadeca-1(10),11,14-triene |
| PubChem CID | 144539743 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 6-methyl-3-oxa-6-azabicyclo[8.5.0]pentadeca-1(10),11,14-triene |
| SMILES | CN1CCCC2=C(C=CCC=C2)COCC1 |
| InChI | InChI=1S/C14H21NO/c1-15-9-5-8-13-6-3-2-4-7-14(13)12-16-11-10-15/h3-4,6-7H,2,5,8-12H2,1H3 |
| InChIKey | YEOMMWZCWBIKRV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methyl-3-oxa-6-azabicyclo[8.5.0]pentadeca-1(10),11,14-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3-oxa-6-azabicyclo[8.5.0]pentadeca-1(10),11,14-triene?
The IUPAC name of 6-methyl-3-oxa-6-azabicyclo[8.5.0]pentadeca-1(10),11,14-triene (CID 144539743) is 6-methyl-3-oxa-6-azabicyclo[8.5.0]pentadeca-1(10),11,14-triene.
What is the SMILES notation for 6-methyl-3-oxa-6-azabicyclo[8.5.0]pentadeca-1(10),11,14-triene?
The canonical SMILES for 6-methyl-3-oxa-6-azabicyclo[8.5.0]pentadeca-1(10),11,14-triene is CN1CCCC2=C(C=CCC=C2)COCC1.
What is the InChIKey of 6-methyl-3-oxa-6-azabicyclo[8.5.0]pentadeca-1(10),11,14-triene?
The InChIKey is YEOMMWZCWBIKRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO/c1-15-9-5-8-13-6-3-2-4-7-14(13)12-16-11-10-15/h3-4,6-7H,2,5,8-12H2,1H3.
What are the key properties of 6-methyl-3-oxa-6-azabicyclo[8.5.0]pentadeca-1(10),11,14-triene?
6-methyl-3-oxa-6-azabicyclo[8.5.0]pentadeca-1(10),11,14-triene has a molecular weight of 219.33 g/mol, XLogP of 2.54, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3-oxa-6-azabicyclo[8.5.0]pentadeca-1(10),11,14-triene is sourced from PubChem (CID 144539743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).