C23H22Cl2FNO2S — CID 144539986
N-[3,5-dichloro-4-[(3E,5Z)-7-fluorohepta-1,3,5-trien-4-yl]phenyl]-2-(4-ethylsulfinylphenyl)acetamide (PubChem CID 144539986) has the molecular formula C23H22Cl2FNO2S and a molecular weight of 466.41 g/mol. Its IUPAC name is N-[3,5-dichloro-4-[(3E,5Z)-7-fluorohepta-1,3,5-trien-4-yl]phenyl]-2-(4-ethylsulfinylphenyl)acetamide.
| Compound Name | N-[3,5-dichloro-4-[(3E,5Z)-7-fluorohepta-1,3,5-trien-4-yl]phenyl]-2-(4-ethylsulfinylphenyl)acetamide |
|---|---|
| PubChem CID | 144539986 |
| Molecular Formula | C23H22Cl2FNO2S |
| Molecular Weight | 466.41 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | N-[3,5-dichloro-4-[(3E,5Z)-7-fluorohepta-1,3,5-trien-4-yl]phenyl]-2-(4-ethylsulfinylphenyl)acetamide |
| SMILES | C=C/C=C(\C=C/CF)c1c(Cl)cc(NC(=O)Cc2ccc(S(=O)CC)cc2)cc1Cl |
| InChI | InChI=1S/C23H22Cl2FNO2S/c1-3-6-17(7-5-12-26)23-20(24)14-18(15-21(23)25)27-22(28)13-16-8-10-19(11-9-16)30(29)4-2/h3,5-11,14-15H,1,4,12-13H2,2H3,(H,27,28)/b7-5-,17-6+ |
| InChIKey | ISNPCWFXAZLJBC-APZVSDDJSA-N |
| XLogP | 6.40 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.41 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|