C16H28N2O — CID 144540102
ethane;1-[(2-methoxy-5-methylphenyl)methyl]-4-methylpiperazine (PubChem CID 144540102) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is ethane;1-[(2-methoxy-5-methylphenyl)methyl]-4-methylpiperazine.
| Compound Name | ethane;1-[(2-methoxy-5-methylphenyl)methyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 144540102 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | ethane;1-[(2-methoxy-5-methylphenyl)methyl]-4-methylpiperazine |
| SMILES | CC.COc1ccc(C)cc1CN1CCN(C)CC1 |
| InChI | InChI=1S/C14H22N2O.C2H6/c1-12-4-5-14(17-3)13(10-12)11-16-8-6-15(2)7-9-16;1-2/h4-5,10H,6-9,11H2,1-3H3;1-2H3 |
| InChIKey | ANSPGWGYCMBHTC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |