About 3-(3,6-dimethylindazol-1-yl)-N,N-dimethylpropan-1-amine;ethane
3-(3,6-dimethylindazol-1-yl)-N,N-dimethylpropan-1-amine;ethane (PubChem CID 144540628) has the molecular formula C16H27N3
and a molecular weight of 261.41 g/mol. Its IUPAC name is 3-(3,6-dimethylindazol-1-yl)-N,N-dimethylpropan-1-amine;ethane.
Molecular Properties
| Compound Name | 3-(3,6-dimethylindazol-1-yl)-N,N-dimethylpropan-1-amine;ethane |
| PubChem CID | 144540628 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | 3-(3,6-dimethylindazol-1-yl)-N,N-dimethylpropan-1-amine;ethane |
| SMILES | CC.Cc1ccc2c(C)nn(CCCN(C)C)c2c1 |
| InChI | InChI=1S/C14H21N3.C2H6/c1-11-6-7-13-12(2)15-17(14(13)10-11)9-5-8-16(3)4;1-2/h6-7,10H,5,8-9H2,1-4H3;1-2H3 |
| InChIKey | ZIGXRVUILUHYDG-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3,6-dimethylindazol-1-yl)-N,N-dimethylpropan-1-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,6-dimethylindazol-1-yl)-N,N-dimethylpropan-1-amine;ethane?
The IUPAC name of 3-(3,6-dimethylindazol-1-yl)-N,N-dimethylpropan-1-amine;ethane (CID 144540628) is 3-(3,6-dimethylindazol-1-yl)-N,N-dimethylpropan-1-amine;ethane.
What is the SMILES notation for 3-(3,6-dimethylindazol-1-yl)-N,N-dimethylpropan-1-amine;ethane?
The canonical SMILES for 3-(3,6-dimethylindazol-1-yl)-N,N-dimethylpropan-1-amine;ethane is CC.Cc1ccc2c(C)nn(CCCN(C)C)c2c1.
What is the InChIKey of 3-(3,6-dimethylindazol-1-yl)-N,N-dimethylpropan-1-amine;ethane?
The InChIKey is ZIGXRVUILUHYDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3.C2H6/c1-11-6-7-13-12(2)15-17(14(13)10-11)9-5-8-16(3)4;1-2/h6-7,10H,5,8-9H2,1-4H3;1-2H3.
What are the key properties of 3-(3,6-dimethylindazol-1-yl)-N,N-dimethylpropan-1-amine;ethane?
3-(3,6-dimethylindazol-1-yl)-N,N-dimethylpropan-1-amine;ethane has a molecular weight of 261.41 g/mol, XLogP of 3.63, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,6-dimethylindazol-1-yl)-N,N-dimethylpropan-1-amine;ethane is sourced from PubChem (CID 144540628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).