About 2-(4,4-dimethyl-2-oxooxolan-3-yl)sulfanylacetaldehyde
2-(4,4-dimethyl-2-oxooxolan-3-yl)sulfanylacetaldehyde (PubChem CID 144540708) has the molecular formula C8H12O3S
and a molecular weight of 188.25 g/mol. Its IUPAC name is 2-(4,4-dimethyl-2-oxooxolan-3-yl)sulfanylacetaldehyde.
Molecular Properties
| Compound Name | 2-(4,4-dimethyl-2-oxooxolan-3-yl)sulfanylacetaldehyde |
| PubChem CID | 144540708 |
| Molecular Formula | C8H12O3S |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | 2-(4,4-dimethyl-2-oxooxolan-3-yl)sulfanylacetaldehyde |
| SMILES | CC1(C)COC(=O)C1SCC=O |
| InChI | InChI=1S/C8H12O3S/c1-8(2)5-11-7(10)6(8)12-4-3-9/h3,6H,4-5H2,1-2H3 |
| InChIKey | WBBDZZIOZQFLLW-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,4-dimethyl-2-oxooxolan-3-yl)sulfanylacetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-dimethyl-2-oxooxolan-3-yl)sulfanylacetaldehyde?
The IUPAC name of 2-(4,4-dimethyl-2-oxooxolan-3-yl)sulfanylacetaldehyde (CID 144540708) is 2-(4,4-dimethyl-2-oxooxolan-3-yl)sulfanylacetaldehyde.
What is the SMILES notation for 2-(4,4-dimethyl-2-oxooxolan-3-yl)sulfanylacetaldehyde?
The canonical SMILES for 2-(4,4-dimethyl-2-oxooxolan-3-yl)sulfanylacetaldehyde is CC1(C)COC(=O)C1SCC=O.
What is the InChIKey of 2-(4,4-dimethyl-2-oxooxolan-3-yl)sulfanylacetaldehyde?
The InChIKey is WBBDZZIOZQFLLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O3S/c1-8(2)5-11-7(10)6(8)12-4-3-9/h3,6H,4-5H2,1-2H3.
What are the key properties of 2-(4,4-dimethyl-2-oxooxolan-3-yl)sulfanylacetaldehyde?
2-(4,4-dimethyl-2-oxooxolan-3-yl)sulfanylacetaldehyde has a molecular weight of 188.25 g/mol, XLogP of 0.87, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-dimethyl-2-oxooxolan-3-yl)sulfanylacetaldehyde is sourced from PubChem (CID 144540708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).