C16H28O2 — CID 144540719
2-[(1S,4R,4aS)-4,7-dimethyl-1,2,3,4,4a,5,6,7-octahydronaphthalen-1-yl]acetic acid;ethane (PubChem CID 144540719) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is 2-[(1S,4R,4aS)-4,7-dimethyl-1,2,3,4,4a,5,6,7-octahydronaphthalen-1-yl]acetic acid;ethane.
| Compound Name | 2-[(1S,4R,4aS)-4,7-dimethyl-1,2,3,4,4a,5,6,7-octahydronaphthalen-1-yl]acetic acid;ethane |
|---|---|
| PubChem CID | 144540719 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 2-[(1S,4R,4aS)-4,7-dimethyl-1,2,3,4,4a,5,6,7-octahydronaphthalen-1-yl]acetic acid;ethane |
| SMILES | CC.CC1C=C2[C@H](CC(=O)O)CC[C@@H](C)[C@@H]2CC1 |
| InChI | InChI=1S/C14H22O2.C2H6/c1-9-3-6-12-10(2)4-5-11(8-14(15)16)13(12)7-9;1-2/h7,9-12H,3-6,8H2,1-2H3,(H,15,16);1-2H3/t9?,10-,11+,12+;/m1./s1 |
| InChIKey | FEYCFIBVHHTTGR-RAGCULPGSA-N |
| XLogP | 4.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|