C13H21NO2 — CID 144540830
N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-3-methoxy-2-methylpropanamide (PubChem CID 144540830) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-3-methoxy-2-methylpropanamide.
| Compound Name | N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-3-methoxy-2-methylpropanamide |
|---|---|
| PubChem CID | 144540830 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-3-methoxy-2-methylpropanamide |
| SMILES | C=C/C=C\C(=C/C)CNC(=O)C(C)COC |
| InChI | InChI=1S/C13H21NO2/c1-5-7-8-12(6-2)9-14-13(15)11(3)10-16-4/h5-8,11H,1,9-10H2,2-4H3,(H,14,15)/b8-7-,12-6+ |
| InChIKey | ROIUSVPEZJROGP-HRZQEMGZSA-N |
| XLogP | 2.07 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|