C17H26FNO2 — CID 144540979
ethane;2-fluoro-4-methyl-N-[2-(oxan-4-yl)ethyl]benzamide (PubChem CID 144540979) has the molecular formula C17H26FNO2 and a molecular weight of 295.40 g/mol. Its IUPAC name is ethane;2-fluoro-4-methyl-N-[2-(oxan-4-yl)ethyl]benzamide.
| Compound Name | ethane;2-fluoro-4-methyl-N-[2-(oxan-4-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 144540979 |
| Molecular Formula | C17H26FNO2 |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | ethane;2-fluoro-4-methyl-N-[2-(oxan-4-yl)ethyl]benzamide |
| SMILES | CC.Cc1ccc(C(=O)NCCC2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C15H20FNO2.C2H6/c1-11-2-3-13(14(16)10-11)15(18)17-7-4-12-5-8-19-9-6-12;1-2/h2-3,10,12H,4-9H2,1H3,(H,17,18);1-2H3 |
| InChIKey | XXQOEIBPDBVSEN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |