C34H37NOS — CID 144541012
(1-methoxy-1-phenylpentan-3-yl)benzene;2-(3-propan-2-yl-1-benzothiophen-2-yl)pyridine (PubChem CID 144541012) has the molecular formula C34H37NOS and a molecular weight of 507.74 g/mol. Its IUPAC name is (1-methoxy-1-phenylpentan-3-yl)benzene;2-(3-propan-2-yl-1-benzothiophen-2-yl)pyridine.
| Compound Name | (1-methoxy-1-phenylpentan-3-yl)benzene;2-(3-propan-2-yl-1-benzothiophen-2-yl)pyridine |
|---|---|
| PubChem CID | 144541012 |
| Molecular Formula | C34H37NOS |
| Molecular Weight | 507.74 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | (1-methoxy-1-phenylpentan-3-yl)benzene;2-(3-propan-2-yl-1-benzothiophen-2-yl)pyridine |
| SMILES | CC(C)c1c(-c2ccccn2)sc2ccccc12.CCC(CC(OC)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H22O.C16H15NS/c1-3-15(16-10-6-4-7-11-16)14-18(19-2)17-12-8-5-9-13-17;1-11(2)15-12-7-3-4-9-14(12)18-16(15)13-8-5-6-10-17-13/h4-13,15,18H,3,14H2,1-2H3;3-11H,1-2H3 |
| InChIKey | CRYBUFHUNVYGSL-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.74 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |