C25H30BrN3S — CID 144541689
2-[[4-[(E)-1-bromopent-2-en-2-yl]-2,5-dimethylphenyl]methyl]-4-(5-tert-butylpyrazin-2-yl)-1,3-thiazole (PubChem CID 144541689) has the molecular formula C25H30BrN3S and a molecular weight of 484.51 g/mol. Its IUPAC name is 2-[[4-[(E)-1-bromopent-2-en-2-yl]-2,5-dimethylphenyl]methyl]-4-(5-tert-butylpyrazin-2-yl)-1,3-thiazole.
| Compound Name | 2-[[4-[(E)-1-bromopent-2-en-2-yl]-2,5-dimethylphenyl]methyl]-4-(5-tert-butylpyrazin-2-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 144541689 |
| Molecular Formula | C25H30BrN3S |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | 2-[[4-[(E)-1-bromopent-2-en-2-yl]-2,5-dimethylphenyl]methyl]-4-(5-tert-butylpyrazin-2-yl)-1,3-thiazole |
| SMILES | CC/C=C(/CBr)c1cc(C)c(Cc2nc(-c3cnc(C(C)(C)C)cn3)cs2)cc1C |
| InChI | InChI=1S/C25H30BrN3S/c1-7-8-18(12-26)20-10-16(2)19(9-17(20)3)11-24-29-22(15-30-24)21-13-28-23(14-27-21)25(4,5)6/h8-10,13-15H,7,11-12H2,1-6H3/b18-8- |
| InChIKey | UNOWWJDIWSBYJP-LSCVHKIXSA-N |
| XLogP | 7.29 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|