About ethane;1-(4-heptylphenyl)ethanimine;1-(4-methylphenyl)sulfanylethanethiol
ethane;1-(4-heptylphenyl)ethanimine;1-(4-methylphenyl)sulfanylethanethiol (PubChem CID 144542006) has the molecular formula C28H47NS2
and a molecular weight of 461.83 g/mol. Its IUPAC name is ethane;1-(4-heptylphenyl)ethanimine;1-(4-methylphenyl)sulfanylethanethiol.
Molecular Properties
| Compound Name | ethane;1-(4-heptylphenyl)ethanimine;1-(4-methylphenyl)sulfanylethanethiol |
| PubChem CID | 144542006 |
| Molecular Formula | C28H47NS2 |
| Molecular Weight | 461.83 g/mol |
| Exact Mass | 461.31 |
| IUPAC Name | ethane;1-(4-heptylphenyl)ethanimine;1-(4-methylphenyl)sulfanylethanethiol |
| SMILES | CC.CC.Cc1ccc(SC(C)S)cc1.[H]/N=C(\C)c1ccc(CCCCCCC)cc1 |
| InChI | InChI=1S/C15H23N.C9H12S2.2C2H6/c1-3-4-5-6-7-8-14-9-11-15(12-10-14)13(2)16;1-7-3-5-9(6-4-7)11-8(2)10;2*1-2/h9-12,16H,3-8H2,1-2H3;3-6,8,10H,1-2H3;2*1-2H3/b16-13+;;; |
| InChIKey | PWVVESIMTWLFID-JMYQSOIMSA-N |
| XLogP | 10.00 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 461.83 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-(4-heptylphenyl)ethanimine;1-(4-methylphenyl)sulfanylethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(4-heptylphenyl)ethanimine;1-(4-methylphenyl)sulfanylethanethiol?
The IUPAC name of ethane;1-(4-heptylphenyl)ethanimine;1-(4-methylphenyl)sulfanylethanethiol (CID 144542006) is ethane;1-(4-heptylphenyl)ethanimine;1-(4-methylphenyl)sulfanylethanethiol.
What is the SMILES notation for ethane;1-(4-heptylphenyl)ethanimine;1-(4-methylphenyl)sulfanylethanethiol?
The canonical SMILES for ethane;1-(4-heptylphenyl)ethanimine;1-(4-methylphenyl)sulfanylethanethiol is CC.CC.Cc1ccc(SC(C)S)cc1.[H]/N=C(\C)c1ccc(CCCCCCC)cc1.
What is the InChIKey of ethane;1-(4-heptylphenyl)ethanimine;1-(4-methylphenyl)sulfanylethanethiol?
The InChIKey is PWVVESIMTWLFID-JMYQSOIMSA-N. The full InChI is InChI=1S/C15H23N.C9H12S2.2C2H6/c1-3-4-5-6-7-8-14-9-11-15(12-10-14)13(2)16;1-7-3-5-9(6-4-7)11-8(2)10;2*1-2/h9-12,16H,3-8H2,1-2H3;3-6,8,10H,1-2H3;2*1-2H3/b16-13+;;;.
What are the key properties of ethane;1-(4-heptylphenyl)ethanimine;1-(4-methylphenyl)sulfanylethanethiol?
ethane;1-(4-heptylphenyl)ethanimine;1-(4-methylphenyl)sulfanylethanethiol has a molecular weight of 461.83 g/mol, XLogP of 10.00, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(4-heptylphenyl)ethanimine;1-(4-methylphenyl)sulfanylethanethiol is sourced from PubChem (CID 144542006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).