C10H15ClFN3S — CID 144542039
ethane;N-[(5-fluoro-3-pyridinyl)-(methylamino)methyl]carbamothioyl chloride (PubChem CID 144542039) has the molecular formula C10H15ClFN3S and a molecular weight of 263.77 g/mol. Its IUPAC name is ethane;N-[(5-fluoro-3-pyridinyl)-(methylamino)methyl]carbamothioyl chloride.
| Compound Name | ethane;N-[(5-fluoro-3-pyridinyl)-(methylamino)methyl]carbamothioyl chloride |
|---|---|
| PubChem CID | 144542039 |
| Molecular Formula | C10H15ClFN3S |
| Molecular Weight | 263.77 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | ethane;N-[(5-fluoro-3-pyridinyl)-(methylamino)methyl]carbamothioyl chloride |
| SMILES | CC.CNC(NC(=S)Cl)c1cncc(F)c1 |
| InChI | InChI=1S/C8H9ClFN3S.C2H6/c1-11-7(13-8(9)14)5-2-6(10)4-12-3-5;1-2/h2-4,7,11H,1H3,(H,13,14);1-2H3 |
| InChIKey | MRFZORXZVQHBTO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.77 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|